Products 2954795-29-8
CAS 2954795-29-8 is the registry number for Anticancer agent 139. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(2,4-dimethylphenyl)-5-(3,4,5-trifluorophenyl)-1,3,4-oxadiazol-2-amine (CAS 2954795-29-8) is a chemical compound with the molecular formula C16H12F3N3O and a molecular weight of 319.28 g/mol. IUPAC name: N-(2,4-dimethylphenyl)-5-(3,4,5-trifluorophenyl)-1,3,4-oxadiazol-2-amine. InChIKey: YVXYCCNBPZAKMF-UHFFFAOYSA-N.
| Molecular formula | C16H12F3N3O |
|---|---|
| Molecular weight | 319.28 g/mol |
| IUPAC name | N-(2,4-dimethylphenyl)-5-(3,4,5-trifluorophenyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | YVXYCCNBPZAKMF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC2=NN=C(O2)C3=CC(=C(C(=C3)F)F)F)C |
Computed by PubChem (NCBI)
Synonyms:
Anticancer agent 139