CAS 2955243-69-1 is the registry number for GP130-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
[5-hydroxy-2-(4-hydroxyphenyl)indol-1-yl]-(2,3,4,5,6-pentafluorophenyl)methanone (CAS 2955243-69-1) is a chemical compound with the molecular formula C21H10F5NO3 and a molecular weight of 419.3 g/mol. IUPAC name: [5-hydroxy-2-(4-hydroxyphenyl)indol-1-yl]-(2,3,4,5,6-pentafluorophenyl)methanone. InChIKey: WGEDVLIIOFBHLD-UHFFFAOYSA-N.
| Molecular formula | C21H10F5NO3 |
|---|---|
| Molecular weight | 419.3 g/mol |
| IUPAC name | [5-hydroxy-2-(4-hydroxyphenyl)indol-1-yl]-(2,3,4,5,6-pentafluorophenyl)methanone |
| InChIKey | WGEDVLIIOFBHLD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC3=C(N2C(=O)C4=C(C(=C(C(=C4F)F)F)F)F)C=CC(=C3)O)O |
Computed by PubChem (NCBI)