Products 2955551-76-3
CAS 2955551-76-3 is the registry number for 1-bromo-2,4,5-trideuterio-6-fluoro-3-nitro-benzene, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
1-bromo-2,4,5-trideuterio-6-fluoro-3-nitrobenzene (CAS 2955551-76-3) is a chemical compound with the molecular formula C6H3BrFNO2 and a molecular weight of 223.01 g/mol. IUPAC name: 1-bromo-2,4,5-trideuterio-6-fluoro-3-nitrobenzene. InChIKey: FAWMTDSAMOCUAR-CBYSEHNBSA-N.
| Molecular formula | C6H3BrFNO2 |
|---|---|
| Molecular weight | 223.01 g/mol |
| IUPAC name | 1-bromo-2,4,5-trideuterio-6-fluoro-3-nitrobenzene |
| InChIKey | FAWMTDSAMOCUAR-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[N+](=O)[O-])[2H])Br)F)[2H] |
Computed by PubChem (NCBI)