CAS 2955552-18-6 is the registry number for 6-oxo-5,7-dihydropyrrolo[2,3-d]pyrimidine-2-sulfonic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-oxo-5,7-dihydropyrrolo[2,3-d]pyrimidine-2-sulfonic acid (CAS 2955552-18-6) is a chemical compound with the molecular formula C6H5N3O4S and a molecular weight of 215.19 g/mol. IUPAC name: 6-oxo-5,7-dihydropyrrolo[2,3-d]pyrimidine-2-sulfonic acid. InChIKey: WKOMYLSAOLXRLQ-UHFFFAOYSA-N.
| Molecular formula | C6H5N3O4S |
|---|---|
| Molecular weight | 215.19 g/mol |
| IUPAC name | 6-oxo-5,7-dihydropyrrolo[2,3-d]pyrimidine-2-sulfonic acid |
| InChIKey | WKOMYLSAOLXRLQ-UHFFFAOYSA-N |
| SMILES | C1C2=CN=C(N=C2NC1=O)S(=O)(=O)O |
Computed by PubChem (NCBI)