Products 2955552-18-6

CAS 2955552-18-6 is the registry number for 6-oxo-5,7-dihydropyrrolo[2,3-d]pyrimidine-2-sulfonic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-oxo-5,7-dihydropyrrolo[2,3-d]pyrimidine-2-sulfonic acid (CAS 2955552-18-6) is a chemical compound with the molecular formula C6H5N3O4S and a molecular weight of 215.19 g/mol. IUPAC name: 6-oxo-5,7-dihydropyrrolo[2,3-d]pyrimidine-2-sulfonic acid. InChIKey: WKOMYLSAOLXRLQ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5N3O4S
Molecular weight215.19 g/mol
IUPAC name6-oxo-5,7-dihydropyrrolo[2,3-d]pyrimidine-2-sulfonic acid
InChIKeyWKOMYLSAOLXRLQ-UHFFFAOYSA-N
SMILESC1C2=CN=C(N=C2NC1=O)S(=O)(=O)O

Computed by PubChem (NCBI)