CAS 2955617-77-1 is the registry number for 2',5'-Dihydroxy-[1,1':4',1''-terphenyl]-3,3'',5,5''-tetracarboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-[4-(3,5-dicarboxyphenyl)-2,5-dihydroxyphenyl]benzene-1,3-dicarboxylic acid (CAS 2955617-77-1) is a chemical compound with the molecular formula C22H14O10 and a molecular weight of 438.3 g/mol. IUPAC name: 5-[4-(3,5-dicarboxyphenyl)-2,5-dihydroxyphenyl]benzene-1,3-dicarboxylic acid. InChIKey: GKKBFFDJNSCCPF-UHFFFAOYSA-N.
| Molecular formula | C22H14O10 |
|---|---|
| Molecular weight | 438.3 g/mol |
| IUPAC name | 5-[4-(3,5-dicarboxyphenyl)-2,5-dihydroxyphenyl]benzene-1,3-dicarboxylic acid |
| InChIKey | GKKBFFDJNSCCPF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)C(=O)O)C2=CC(=C(C=C2O)C3=CC(=CC(=C3)C(=O)O)C(=O)O)O |
Computed by PubChem (NCBI)