Products 18959-88-1
CAS 18959-88-1 appears in our catalog under these names: 4,4'-(1,4-Phenylenebis(oxy))diphthalic acid, 98%, 4,4'-(1,4-Phenylenebis(oxy))diphthalic acid. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
4-[4-(3,4-dicarboxyphenoxy)phenoxy]phthalic acid (CAS 18959-88-1) is a chemical compound with the molecular formula C22H14O10 and a molecular weight of 438.3 g/mol. IUPAC name: 4-[4-(3,4-dicarboxyphenoxy)phenoxy]phthalic acid. InChIKey: QCQPSSJUXNVOBU-UHFFFAOYSA-N.
| Molecular formula | C22H14O10 |
|---|---|
| Molecular weight | 438.3 g/mol |
| IUPAC name | 4-[4-(3,4-dicarboxyphenoxy)phenoxy]phthalic acid |
| InChIKey | QCQPSSJUXNVOBU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=CC(=C(C=C2)C(=O)O)C(=O)O)OC3=CC(=C(C=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)