CAS 2955618-24-1 appears in our catalog under these names: (S)–SKBG–1, (S)-SKBG-1, 99.01%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10 mg, 25 mg, 5 mg.
(2S)-4-(2-chloroacetyl)-N-[(4-methoxyphenyl)methyl]-1-(4-methoxyphenyl)sulfonylpiperazine-2-carboxamide (CAS 2955618-24-1) is a chemical compound with the molecular formula C22H26ClN3O6S and a molecular weight of 496.0 g/mol. IUPAC name: (2S)-4-(2-chloroacetyl)-N-[(4-methoxyphenyl)methyl]-1-(4-methoxyphenyl)sulfonylpiperazine-2-carboxamide. InChIKey: SXQZEMXQTRNLRZ-FQEVSTJZSA-N.
| Molecular formula | C22H26ClN3O6S |
|---|---|
| Molecular weight | 496.0 g/mol |
| IUPAC name | (2S)-4-(2-chloroacetyl)-N-[(4-methoxyphenyl)methyl]-1-(4-methoxyphenyl)sulfonylpiperazine-2-carboxamide |
| InChIKey | SXQZEMXQTRNLRZ-FQEVSTJZSA-N |
| SMILES | COC1=CC=C(C=C1)CNC(=O)[C@@H]2CN(CCN2S(=O)(=O)C3=CC=C(C=C3)OC)C(=O)CCl |
Computed by PubChem (NCBI)