CAS 29559-44-2 is the registry number for 1,3–Diadamantan–1–ylurea. Offered by: GLPBio. Available pack sizes: 25mg.
1,3-bis(1-adamantyl)urea (CAS 29559-44-2) is a chemical compound with the molecular formula C21H32N2O and a molecular weight of 328.5 g/mol. IUPAC name: 1,3-bis(1-adamantyl)urea. InChIKey: CHZFWQHXHXBIQH-UHFFFAOYSA-N.
| Molecular formula | C21H32N2O |
|---|---|
| Molecular weight | 328.5 g/mol |
| IUPAC name | 1,3-bis(1-adamantyl)urea |
| InChIKey | CHZFWQHXHXBIQH-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)NC(=O)NC45CC6CC(C4)CC(C6)C5 |
Computed by PubChem (NCBI)