CAS 2956014-05-2 is the registry number for NLRP3-IN-58. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(6-chloro-1H-indol-3-yl)-N-[3-(phenylsulfamoyl)phenyl]acetamide (CAS 2956014-05-2) is a chemical compound with the molecular formula C22H18ClN3O3S and a molecular weight of 439.9 g/mol. IUPAC name: 2-(6-chloro-1H-indol-3-yl)-N-[3-(phenylsulfamoyl)phenyl]acetamide. InChIKey: YVGCNJKXZQAWIA-UHFFFAOYSA-N.
| Molecular formula | C22H18ClN3O3S |
|---|---|
| Molecular weight | 439.9 g/mol |
| IUPAC name | 2-(6-chloro-1H-indol-3-yl)-N-[3-(phenylsulfamoyl)phenyl]acetamide |
| InChIKey | YVGCNJKXZQAWIA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NS(=O)(=O)C2=CC=CC(=C2)NC(=O)CC3=CNC4=C3C=CC(=C4)Cl |
Computed by PubChem (NCBI)