CAS 2956493-45-9 is the registry number for (R)-5-Methyl-6,6,12-triphenyl-5,6,7,12-tetrahydroindolo[2,3-b]carbazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methyl-6,6,12-triphenyl-7,12-dihydroindolo[2,3-b]carbazole (CAS 2956493-45-9) is a chemical compound with the molecular formula C37H28N2 and a molecular weight of 500.6 g/mol. IUPAC name: 5-methyl-6,6,12-triphenyl-7,12-dihydroindolo[2,3-b]carbazole. InChIKey: HSGQGRKYVRWBKK-UHFFFAOYSA-N.
| Molecular formula | C37H28N2 |
|---|---|
| Molecular weight | 500.6 g/mol |
| IUPAC name | 5-methyl-6,6,12-triphenyl-7,12-dihydroindolo[2,3-b]carbazole |
| InChIKey | HSGQGRKYVRWBKK-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C3=C1C(C4=C(C3C5=CC=CC=C5)C6=CC=CC=C6N4)(C7=CC=CC=C7)C8=CC=CC=C8 |
Computed by PubChem (NCBI)