CAS 2956493-93-7 is the registry number for (5,7-Dichloro-3-(hydroxy(phenyl)methyl)-1H-indol-2-yl)diphenylmethanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[5,7-dichloro-3-[hydroxy(phenyl)methyl]-1H-indol-2-yl]-diphenylmethanol (CAS 2956493-93-7) is a chemical compound with the molecular formula C28H21Cl2NO2 and a molecular weight of 474.4 g/mol. IUPAC name: [5,7-dichloro-3-[hydroxy(phenyl)methyl]-1H-indol-2-yl]-diphenylmethanol. InChIKey: VDXXVOZDOGSIJN-UHFFFAOYSA-N.
| Molecular formula | C28H21Cl2NO2 |
|---|---|
| Molecular weight | 474.4 g/mol |
| IUPAC name | [5,7-dichloro-3-[hydroxy(phenyl)methyl]-1H-indol-2-yl]-diphenylmethanol |
| InChIKey | VDXXVOZDOGSIJN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=C(NC3=C2C=C(C=C3Cl)Cl)C(C4=CC=CC=C4)(C5=CC=CC=C5)O)O |
Computed by PubChem (NCBI)