Products 2956809-82-6
CAS 2956809-82-6 is the registry number for Gamma-Glutamyl Transferase-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(2,4-difluoroanilino)carbamoyl]-9H-pyrido[3,4-b]indole-3-carboxamide (CAS 2956809-82-6) is a chemical compound with the molecular formula C19H13F2N5O2 and a molecular weight of 381.3 g/mol. IUPAC name: 1-[(2,4-difluoroanilino)carbamoyl]-9H-pyrido[3,4-b]indole-3-carboxamide. InChIKey: PKUTZLNTXWOVCP-UHFFFAOYSA-N.
| Molecular formula | C19H13F2N5O2 |
|---|---|
| Molecular weight | 381.3 g/mol |
| IUPAC name | 1-[(2,4-difluoroanilino)carbamoyl]-9H-pyrido[3,4-b]indole-3-carboxamide |
| InChIKey | PKUTZLNTXWOVCP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC(=NC(=C3N2)C(=O)NNC4=C(C=C(C=C4)F)F)C(=O)N |
Computed by PubChem (NCBI)
Synonyms:
Gamma-Glutamyl Transferase-IN-2