Products 2962103-54-2
CAS 2962103-54-2 is the registry number for ZG-2305. Offered by: MedChemExpress. Available pack sizes: 5 mg, 25 mg, 50 mg, 10 mg.
2-[[5-[3-(3,5-dichlorophenyl)-1,2-oxazol-5-yl]-3-hydroxypyridine-2-carbonyl]amino]acetic acid (CAS 2962103-54-2) is a chemical compound with the molecular formula C17H11Cl2N3O5 and a molecular weight of 408.2 g/mol. IUPAC name: 2-[[5-[3-(3,5-dichlorophenyl)-1,2-oxazol-5-yl]-3-hydroxypyridine-2-carbonyl]amino]acetic acid. InChIKey: IVVBSKSURSLYFK-UHFFFAOYSA-N.
| Molecular formula | C17H11Cl2N3O5 |
|---|---|
| Molecular weight | 408.2 g/mol |
| IUPAC name | 2-[[5-[3-(3,5-dichlorophenyl)-1,2-oxazol-5-yl]-3-hydroxypyridine-2-carbonyl]amino]acetic acid |
| InChIKey | IVVBSKSURSLYFK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C2=NOC(=C2)C3=CC(=C(N=C3)C(=O)NCC(=O)O)O |
Computed by PubChem (NCBI)