CAS 296248-49-2 appears in our catalog under these names: Cladribine Impurity 2, Capecitabine Impurity 17, Capecitabine Impurity 28, Capecitabine Impurity M. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
Methyl N-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]carbamate (CAS 296248-49-2) is a chemical compound with the molecular formula C11H14FN3O6 and a molecular weight of 303.24 g/mol. IUPAC name: methyl N-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]carbamate. InChIKey: KYPRNCZVBFLOSP-FJGDRVTGSA-N.
| Molecular formula | C11H14FN3O6 |
|---|---|
| Molecular weight | 303.24 g/mol |
| IUPAC name | methyl N-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]carbamate |
| InChIKey | KYPRNCZVBFLOSP-FJGDRVTGSA-N |
| SMILES | C[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=C(C(=NC2=O)NC(=O)OC)F)O)O |
Computed by PubChem (NCBI)