CAS 2962941-25-7 is the registry number for FGFR-IN-13. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[4-[[6-(3,5-dimethoxyphenyl)purin-9-yl]methyl]phenyl]prop-2-enamide (CAS 2962941-25-7) is a chemical compound with the molecular formula C23H21N5O3 and a molecular weight of 415.4 g/mol. IUPAC name: N-[4-[[6-(3,5-dimethoxyphenyl)purin-9-yl]methyl]phenyl]prop-2-enamide. InChIKey: FDYYKFWGYGBXLY-UHFFFAOYSA-N.
| Molecular formula | C23H21N5O3 |
|---|---|
| Molecular weight | 415.4 g/mol |
| IUPAC name | N-[4-[[6-(3,5-dimethoxyphenyl)purin-9-yl]methyl]phenyl]prop-2-enamide |
| InChIKey | FDYYKFWGYGBXLY-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C2=C3C(=NC=N2)N(C=N3)CC4=CC=C(C=C4)NC(=O)C=C)OC |
Computed by PubChem (NCBI)