Products 2962967-27-5
CAS 2962967-27-5 appears in our catalog under these names: CRBN ligand-11, 98%, 98%, CRBN ligand-11, 99.94%, CRBN ligand-11, 98%. Offered by: Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 1 g, 100 mg, 10 g, 500 mg, 250 mg.
3-(4-bromo-3-fluoroanilino)piperidine-2,6-dione (CAS 2962967-27-5) is a chemical compound with the molecular formula C11H10BrFN2O2 and a molecular weight of 301.11 g/mol. IUPAC name: 3-(4-bromo-3-fluoroanilino)piperidine-2,6-dione. InChIKey: FLHIBZQROGIVEX-UHFFFAOYSA-N.
| Molecular formula | C11H10BrFN2O2 |
|---|---|
| Molecular weight | 301.11 g/mol |
| IUPAC name | 3-(4-bromo-3-fluoroanilino)piperidine-2,6-dione |
| InChIKey | FLHIBZQROGIVEX-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1NC2=CC(=C(C=C2)Br)F |
Computed by PubChem (NCBI)