CAS 2963-75-9 is the registry number for Butyrylcholine chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 50g.
Trimethyl(2-pentanoyloxyethyl)azanium iodide (CAS 2963-75-9) is a chemical compound with the molecular formula C10H22INO2 and a molecular weight of 315.19 g/mol. IUPAC name: trimethyl(2-pentanoyloxyethyl)azanium iodide. InChIKey: RWGZXGARZIWPQA-UHFFFAOYSA-M.
| Molecular formula | C10H22INO2 |
|---|---|
| Molecular weight | 315.19 g/mol |
| IUPAC name | trimethyl(2-pentanoyloxyethyl)azanium iodide |
| InChIKey | RWGZXGARZIWPQA-UHFFFAOYSA-M |
| SMILES | CCCCC(=O)OCC[N+](C)(C)C.[I-] |
Computed by PubChem (NCBI)