Products 2963-75-9

CAS 2963-75-9 is the registry number for Butyrylcholine chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 50g.

Structural formula: {0} (CAS {1})

Trimethyl(2-pentanoyloxyethyl)azanium iodide (CAS 2963-75-9) is a chemical compound with the molecular formula C10H22INO2 and a molecular weight of 315.19 g/mol. IUPAC name: trimethyl(2-pentanoyloxyethyl)azanium iodide. InChIKey: RWGZXGARZIWPQA-UHFFFAOYSA-M.

Identity
Molecular formulaC10H22INO2
Molecular weight315.19 g/mol
IUPAC nametrimethyl(2-pentanoyloxyethyl)azanium iodide
InChIKeyRWGZXGARZIWPQA-UHFFFAOYSA-M
SMILESCCCCC(=O)OCC[N+](C)(C)C.[I-]

Computed by PubChem (NCBI)