CAS 2963581-29-3 is the registry number for AC10142A. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-ethyl-2-[3-methyl-5-[[(1S)-1-phenylethyl]amino]pyrazol-1-yl]-1H-pyrimidin-6-one (CAS 2963581-29-3) is a chemical compound with the molecular formula C18H21N5O and a molecular weight of 323.4 g/mol. IUPAC name: 4-ethyl-2-[3-methyl-5-[[(1S)-1-phenylethyl]amino]pyrazol-1-yl]-1H-pyrimidin-6-one. InChIKey: CAWNPHNPLIIGTM-ZDUSSCGKSA-N.
| Molecular formula | C18H21N5O |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 4-ethyl-2-[3-methyl-5-[[(1S)-1-phenylethyl]amino]pyrazol-1-yl]-1H-pyrimidin-6-one |
| InChIKey | CAWNPHNPLIIGTM-ZDUSSCGKSA-N |
| SMILES | CCC1=CC(=O)NC(=N1)N2C(=CC(=N2)C)N[C@@H](C)C3=CC=CC=C3 |
Computed by PubChem (NCBI)