Products 29636-70-2
CAS 29636-70-2 is the registry number for 1,7-Di(methyl-d3)-naphthalene. Offered by: TRC. Available pack sizes: 25mg.
1,7-bis(trideuteriomethyl)naphthalene (CAS 29636-70-2) is a chemical compound with the molecular formula C12H12 and a molecular weight of 162.26 g/mol. IUPAC name: 1,7-bis(trideuteriomethyl)naphthalene. InChIKey: SPUWFVKLHHEKGV-WFGJKAKNSA-N.
| Molecular formula | C12H12 |
|---|---|
| Molecular weight | 162.26 g/mol |
| IUPAC name | 1,7-bis(trideuteriomethyl)naphthalene |
| InChIKey | SPUWFVKLHHEKGV-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC2=C(C=CC=C2C=C1)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)