CAS 29641-87-0 is the registry number for Bexarotene Impurity 8. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
1-ethyl-1,3,3,5-tetramethyl-2H-indene (CAS 29641-87-0) is a chemical compound with the molecular formula C15H22 and a molecular weight of 202.33 g/mol. IUPAC name: 1-ethyl-1,3,3,5-tetramethyl-2H-indene. InChIKey: KKMBLJGUCACOQG-UHFFFAOYSA-N.
| Molecular formula | C15H22 |
|---|---|
| Molecular weight | 202.33 g/mol |
| IUPAC name | 1-ethyl-1,3,3,5-tetramethyl-2H-indene |
| InChIKey | KKMBLJGUCACOQG-UHFFFAOYSA-N |
| SMILES | CCC1(CC(C2=C1C=CC(=C2)C)(C)C)C |
Computed by PubChem (NCBI)