CAS 19419-67-1 is the registry number for (S)-ar-Himachalene. Offered by: TRC, Biosynth. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg.
(9S)-3,5,5,9-tetramethyl-6,7,8,9-tetrahydrobenzo[7]annulene (CAS 19419-67-1) is a chemical compound with the molecular formula C15H22 and a molecular weight of 202.33 g/mol. IUPAC name: (9S)-3,5,5,9-tetramethyl-6,7,8,9-tetrahydrobenzo[7]annulene. InChIKey: RIHWULAZACSXEV-LBPRGKRZSA-N.
| Molecular formula | C15H22 |
|---|---|
| Molecular weight | 202.33 g/mol |
| IUPAC name | (9S)-3,5,5,9-tetramethyl-6,7,8,9-tetrahydrobenzo[7]annulene |
| InChIKey | RIHWULAZACSXEV-LBPRGKRZSA-N |
| SMILES | C[C@H]1CCCC(C2=C1C=CC(=C2)C)(C)C |
Computed by PubChem (NCBI)