CAS 2964559-19-9 is the registry number for Sodium Pentanoate-d9, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g.
Sodium 2,2,3,3,4,4,5,5,5-nonadeuteriopentanoate (CAS 2964559-19-9) is a chemical compound with the molecular formula C5H9NaO2 and a molecular weight of 133.17 g/mol. IUPAC name: sodium 2,2,3,3,4,4,5,5,5-nonadeuteriopentanoate. InChIKey: LHYPLJGBYPAQAK-SRKCJUICSA-M.
| Molecular formula | C5H9NaO2 |
|---|---|
| Molecular weight | 133.17 g/mol |
| IUPAC name | sodium 2,2,3,3,4,4,5,5,5-nonadeuteriopentanoate |
| InChIKey | LHYPLJGBYPAQAK-SRKCJUICSA-M |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)