CAS 2966790-98-5 appears in our catalog under these names: Tubulin polymerization–IN–56, Tubulin polymerization-IN-56, 99.96%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 10mg, 100 mg, 25 mg, 10 mg, 5 mg, 50 mg.
6-(6-methyl-3-pyridinyl)-1-(3,4,5-trimethoxyphenyl)indazole;hydrochloride (CAS 2966790-98-5) is a chemical compound with the molecular formula C22H22ClN3O3 and a molecular weight of 411.9 g/mol. IUPAC name: 6-(6-methyl-3-pyridinyl)-1-(3,4,5-trimethoxyphenyl)indazole;hydrochloride. InChIKey: WDNWWTXWTVQXBF-UHFFFAOYSA-N.
| Molecular formula | C22H22ClN3O3 |
|---|---|
| Molecular weight | 411.9 g/mol |
| IUPAC name | 6-(6-methyl-3-pyridinyl)-1-(3,4,5-trimethoxyphenyl)indazole;hydrochloride |
| InChIKey | WDNWWTXWTVQXBF-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C=C1)C2=CC3=C(C=C2)C=NN3C4=CC(=C(C(=C4)OC)OC)OC.Cl |
Computed by PubChem (NCBI)