Products 29671-75-8

CAS 29671-75-8 is the registry number for 3,3-Dichloroprop-2-ene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3,3-dichloroprop-2-ene-1-sulfonyl chloride (CAS 29671-75-8) is a chemical compound with the molecular formula C3H3Cl3O2S and a molecular weight of 209.5 g/mol. IUPAC name: 3,3-dichloroprop-2-ene-1-sulfonyl chloride. InChIKey: QYQIDRLWFIMQPX-UHFFFAOYSA-N.

Identity
Molecular formulaC3H3Cl3O2S
Molecular weight209.5 g/mol
IUPAC name3,3-dichloroprop-2-ene-1-sulfonyl chloride
InChIKeyQYQIDRLWFIMQPX-UHFFFAOYSA-N
SMILESC(C=C(Cl)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)