Products 2967296-91-7
CAS 2967296-91-7 is the registry number for COX-1/2-IN-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(4-tert-butylphenyl)-2-(3-methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxamide (CAS 2967296-91-7) is a chemical compound with the molecular formula C22H24N2O2S and a molecular weight of 380.5 g/mol. IUPAC name: N-(4-tert-butylphenyl)-2-(3-methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxamide. InChIKey: LVWLJRCNLLCLBW-UHFFFAOYSA-N.
| Molecular formula | C22H24N2O2S |
|---|---|
| Molecular weight | 380.5 g/mol |
| IUPAC name | N-(4-tert-butylphenyl)-2-(3-methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxamide |
| InChIKey | LVWLJRCNLLCLBW-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC(=CC=C2)OC)C(=O)NC3=CC=C(C=C3)C(C)(C)C |
Computed by PubChem (NCBI)