Products 2967648-29-7
CAS 2967648-29-7 is the registry number for UNC9750. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[3-(1-cyclobutylpiperidin-4-yl)phenyl]-5-(2H-tetrazol-5-yl)-2,1-benzoxazole (CAS 2967648-29-7) is a chemical compound with the molecular formula C23H24N6O and a molecular weight of 400.5 g/mol. IUPAC name: 3-[3-(1-cyclobutylpiperidin-4-yl)phenyl]-5-(2H-tetrazol-5-yl)-2,1-benzoxazole. InChIKey: JZWSGCNSEOEUCD-UHFFFAOYSA-N.
| Molecular formula | C23H24N6O |
|---|---|
| Molecular weight | 400.5 g/mol |
| IUPAC name | 3-[3-(1-cyclobutylpiperidin-4-yl)phenyl]-5-(2H-tetrazol-5-yl)-2,1-benzoxazole |
| InChIKey | JZWSGCNSEOEUCD-UHFFFAOYSA-N |
| SMILES | C1CC(C1)N2CCC(CC2)C3=CC=CC(=C3)C4=C5C=C(C=CC5=NO4)C6=NNN=N6 |
Computed by PubChem (NCBI)
Synonyms:
orb3136506, YJH