CAS 296771-78-3 is the registry number for 2,3-dimethyl-1-phenyl-4-((8-quinolylsulfonyl)amino)-3-pyrazolin-5-one. Offered by: Biosynth. Available pack sizes: 250mg.
N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)quinoline-8-sulfonamide (CAS 296771-78-3) is a chemical compound with the molecular formula C20H18N4O3S and a molecular weight of 394.4 g/mol. IUPAC name: N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)quinoline-8-sulfonamide. InChIKey: SPXHFUGRVINCDQ-UHFFFAOYSA-N.
| Molecular formula | C20H18N4O3S |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)quinoline-8-sulfonamide |
| InChIKey | SPXHFUGRVINCDQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)NS(=O)(=O)C3=CC=CC4=C3N=CC=C4 |
Computed by PubChem (NCBI)