CAS 296790-70-0 is the registry number for IL-6-IN-2, 99.95%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 50 mg, 5 mg, 10 mg, 100 mg.
5-methyl-4-[(5-methylfuran-2-yl)-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methyl]-2-phenyl-1H-pyrazol-3-one (CAS 296790-70-0) is a chemical compound with the molecular formula C26H24N4O3 and a molecular weight of 440.5 g/mol. IUPAC name: 5-methyl-4-[(5-methylfuran-2-yl)-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methyl]-2-phenyl-1H-pyrazol-3-one. InChIKey: NFIBXZLLMXOARD-UHFFFAOYSA-N.
| Molecular formula | C26H24N4O3 |
|---|---|
| Molecular weight | 440.5 g/mol |
| IUPAC name | 5-methyl-4-[(5-methylfuran-2-yl)-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methyl]-2-phenyl-1H-pyrazol-3-one |
| InChIKey | NFIBXZLLMXOARD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(O1)C(C2=C(NN(C2=O)C3=CC=CC=C3)C)C4=C(NN(C4=O)C5=CC=CC=C5)C |
Computed by PubChem (NCBI)