CAS 296897-97-7 is the registry number for 2,5-Dimethyl-1-(4-((4-nitrophenyl)thio)phenyl)-1H-pyrrole-3-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,5-dimethyl-1-[4-(4-nitrophenyl)sulfanylphenyl]pyrrole-3-carbaldehyde (CAS 296897-97-7) is a chemical compound with the molecular formula C19H16N2O3S and a molecular weight of 352.4 g/mol. IUPAC name: 2,5-dimethyl-1-[4-(4-nitrophenyl)sulfanylphenyl]pyrrole-3-carbaldehyde. InChIKey: KNPBFLGBPCWAIR-UHFFFAOYSA-N.
| Molecular formula | C19H16N2O3S |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | 2,5-dimethyl-1-[4-(4-nitrophenyl)sulfanylphenyl]pyrrole-3-carbaldehyde |
| InChIKey | KNPBFLGBPCWAIR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC=C(C=C2)SC3=CC=C(C=C3)[N+](=O)[O-])C)C=O |
Computed by PubChem (NCBI)