Products 2969213-59-8
CAS 2969213-59-8 is the registry number for ATX inhibitor 22. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,4-dichloro-N-(4-chloro-3,5-difluorophenyl)-5-[methylsulfonyl(oxan-4-yl)amino]benzamide (CAS 2969213-59-8) is a chemical compound with the molecular formula C19H17Cl3F2N2O4S and a molecular weight of 513.8 g/mol. IUPAC name: 2,4-dichloro-N-(4-chloro-3,5-difluorophenyl)-5-[methylsulfonyl(oxan-4-yl)amino]benzamide. InChIKey: WKNIKXGBWCWGCD-UHFFFAOYSA-N.
| Molecular formula | C19H17Cl3F2N2O4S |
|---|---|
| Molecular weight | 513.8 g/mol |
| IUPAC name | 2,4-dichloro-N-(4-chloro-3,5-difluorophenyl)-5-[methylsulfonyl(oxan-4-yl)amino]benzamide |
| InChIKey | WKNIKXGBWCWGCD-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N(C1CCOCC1)C2=C(C=C(C(=C2)C(=O)NC3=CC(=C(C(=C3)F)Cl)F)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
ATX inhibitor 22