CAS 2969259-94-5 is the registry number for 2'-fluoro-5'-(trifluoromethyl)-1,2,3,4-tetrahydro-[1,1'-biphenyl]-1-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-[2-fluoro-5-(trifluoromethyl)phenyl]cyclohex-2-en-1-ol (CAS 2969259-94-5) is a chemical compound with the molecular formula C13H12F4O and a molecular weight of 260.23 g/mol. IUPAC name: 1-[2-fluoro-5-(trifluoromethyl)phenyl]cyclohex-2-en-1-ol. InChIKey: OQYHEIWRECUSKT-UHFFFAOYSA-N.
| Molecular formula | C13H12F4O |
|---|---|
| Molecular weight | 260.23 g/mol |
| IUPAC name | 1-[2-fluoro-5-(trifluoromethyl)phenyl]cyclohex-2-en-1-ol |
| InChIKey | OQYHEIWRECUSKT-UHFFFAOYSA-N |
| SMILES | C1CC=CC(C1)(C2=C(C=CC(=C2)C(F)(F)F)F)O |
Computed by PubChem (NCBI)