Products 2969311-02-0
CAS 2969311-02-0 is the registry number for tert-butyl 3-methoxy-2,5-dimethylbenzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 3-methoxy-2,5-dimethylbenzoate (CAS 2969311-02-0) is a chemical compound with the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. IUPAC name: tert-butyl 3-methoxy-2,5-dimethylbenzoate. InChIKey: YMRZQAVKOIFCIC-UHFFFAOYSA-N.
| Molecular formula | C14H20O3 |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | tert-butyl 3-methoxy-2,5-dimethylbenzoate |
| InChIKey | YMRZQAVKOIFCIC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)OC)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)