Products 2969324-15-8
CAS 2969324-15-8 is the registry number for [1,1':3',1''-terphenyl]-5'-yl(methyl)sulfane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-methylsulfanyl-3,5-diphenylbenzene (CAS 2969324-15-8) is a chemical compound with the molecular formula C19H16S and a molecular weight of 276.4 g/mol. IUPAC name: 1-methylsulfanyl-3,5-diphenylbenzene. InChIKey: BGHILYVGDPFFCW-UHFFFAOYSA-N.
| Molecular formula | C19H16S |
|---|---|
| Molecular weight | 276.4 g/mol |
| IUPAC name | 1-methylsulfanyl-3,5-diphenylbenzene |
| InChIKey | BGHILYVGDPFFCW-UHFFFAOYSA-N |
| SMILES | CSC1=CC(=CC(=C1)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)