CAS 2969353-28-2 is the registry number for (2-fluoro-3,4-dimethylphenyl)trimethylsilane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2-fluoro-3,4-dimethylphenyl)-trimethylsilane (CAS 2969353-28-2) is a chemical compound with the molecular formula C11H17FSi and a molecular weight of 196.34 g/mol. IUPAC name: (2-fluoro-3,4-dimethylphenyl)-trimethylsilane. InChIKey: HMTPTIVBZSTPKZ-UHFFFAOYSA-N.
| Molecular formula | C11H17FSi |
|---|---|
| Molecular weight | 196.34 g/mol |
| IUPAC name | (2-fluoro-3,4-dimethylphenyl)-trimethylsilane |
| InChIKey | HMTPTIVBZSTPKZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)[Si](C)(C)C)F)C |
Computed by PubChem (NCBI)