Products 2969380-92-3
CAS 2969380-92-3 is the registry number for tert-butyl 3-(3-chloro-2-fluorophenyl)-3-hydroxyazetidine-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 3-(3-chloro-2-fluorophenyl)-3-hydroxyazetidine-1-carboxylate (CAS 2969380-92-3) is a chemical compound with the molecular formula C14H17ClFNO3 and a molecular weight of 301.74 g/mol. IUPAC name: tert-butyl 3-(3-chloro-2-fluorophenyl)-3-hydroxyazetidine-1-carboxylate. InChIKey: YUZVLUFPCXJFTC-UHFFFAOYSA-N.
| Molecular formula | C14H17ClFNO3 |
|---|---|
| Molecular weight | 301.74 g/mol |
| IUPAC name | tert-butyl 3-(3-chloro-2-fluorophenyl)-3-hydroxyazetidine-1-carboxylate |
| InChIKey | YUZVLUFPCXJFTC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(C2=C(C(=CC=C2)Cl)F)O |
Computed by PubChem (NCBI)