Products 2969398-06-7
CAS 2969398-06-7 is the registry number for 1-(3-bromo-2-chloro-6-fluorophenyl)propan-1-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(3-bromo-2-chloro-6-fluorophenyl)propan-1-ol (CAS 2969398-06-7) is a chemical compound with the molecular formula C9H9BrClFO and a molecular weight of 267.52 g/mol. IUPAC name: 1-(3-bromo-2-chloro-6-fluorophenyl)propan-1-ol. InChIKey: KNHGCUXIAVQZPV-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClFO |
|---|---|
| Molecular weight | 267.52 g/mol |
| IUPAC name | 1-(3-bromo-2-chloro-6-fluorophenyl)propan-1-ol |
| InChIKey | KNHGCUXIAVQZPV-UHFFFAOYSA-N |
| SMILES | CCC(C1=C(C=CC(=C1Cl)Br)F)O |
Computed by PubChem (NCBI)