Products 2969438-33-1
CAS 2969438-33-1 is the registry number for 1-(4-bromo-3-chlorophenyl)-N,N-dimethylmethanamine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(4-bromo-3-chlorophenyl)-N,N-dimethylmethanamine;hydrochloride (CAS 2969438-33-1) is a chemical compound with the molecular formula C9H12BrCl2N and a molecular weight of 285.00 g/mol. IUPAC name: 1-(4-bromo-3-chlorophenyl)-N,N-dimethylmethanamine;hydrochloride. InChIKey: RWNQBTZGWVGLHQ-UHFFFAOYSA-N.
| Molecular formula | C9H12BrCl2N |
|---|---|
| Molecular weight | 285.00 g/mol |
| IUPAC name | 1-(4-bromo-3-chlorophenyl)-N,N-dimethylmethanamine;hydrochloride |
| InChIKey | RWNQBTZGWVGLHQ-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=CC(=C(C=C1)Br)Cl.Cl |
Computed by PubChem (NCBI)