Products 2969444-74-2
CAS 2969444-74-2 is the registry number for (2-(trifluoromethyl)-1,4-phenylene)bis(methylsulfane), 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,4-bis(methylsulfanyl)-2-(trifluoromethyl)benzene (CAS 2969444-74-2) is a chemical compound with the molecular formula C9H9F3S2 and a molecular weight of 238.3 g/mol. IUPAC name: 1,4-bis(methylsulfanyl)-2-(trifluoromethyl)benzene. InChIKey: IOQDKEUHRMLXTA-UHFFFAOYSA-N.
| Molecular formula | C9H9F3S2 |
|---|---|
| Molecular weight | 238.3 g/mol |
| IUPAC name | 1,4-bis(methylsulfanyl)-2-(trifluoromethyl)benzene |
| InChIKey | IOQDKEUHRMLXTA-UHFFFAOYSA-N |
| SMILES | CSC1=CC(=C(C=C1)SC)C(F)(F)F |
Computed by PubChem (NCBI)