Products 2970213-65-9
CAS 2970213-65-9 is the registry number for hemi(oxalic acid) spiro[3.3]heptan-2-ylmethanamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Oxalic acid;bis(spiro[3.3]heptan-2-ylmethanamine) (CAS 2970213-65-9) is a chemical compound with the molecular formula C18H32N2O4 and a molecular weight of 340.5 g/mol. IUPAC name: oxalic acid;bis(spiro[3.3]heptan-2-ylmethanamine). InChIKey: BIUXQDZMEZFMRR-UHFFFAOYSA-N.
| Molecular formula | C18H32N2O4 |
|---|---|
| Molecular weight | 340.5 g/mol |
| IUPAC name | oxalic acid;bis(spiro[3.3]heptan-2-ylmethanamine) |
| InChIKey | BIUXQDZMEZFMRR-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)CC(C2)CN.C1CC2(C1)CC(C2)CN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)