Products 2970214-26-5
CAS 2970214-26-5 is the registry number for 6-iodo-2,3-dihydrobenzofuran-3-amine,hydrochloride, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
6-iodo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 2970214-26-5) is a chemical compound with the molecular formula C8H9ClINO and a molecular weight of 297.52 g/mol. IUPAC name: 6-iodo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: HFTNBRYEUVVDLZ-UHFFFAOYSA-N.
| Molecular formula | C8H9ClINO |
|---|---|
| Molecular weight | 297.52 g/mol |
| IUPAC name | 6-iodo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| InChIKey | HFTNBRYEUVVDLZ-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(O1)C=C(C=C2)I)N.Cl |
Computed by PubChem (NCBI)