CAS 2970214-27-6 is the registry number for sodium hydride,thieno[3,2-c]pyridine-4-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
CAS 2970214-27-6 identifies a chemical compound with the molecular formula C8H5NNaO2S and a molecular weight of 202.19 g/mol. InChIKey: IFSKJEMKBILTOF-UHFFFAOYSA-N.
| Molecular formula | C8H5NNaO2S |
|---|---|
| Molecular weight | 202.19 g/mol |
| InChIKey | IFSKJEMKBILTOF-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C2=C1SC=C2)C(=O)O.[Na] |
Computed by PubChem (NCBI)