CAS 29706-84-1 appears in our catalog under these names: Zidovudine Impurity 2, Zidovudine EP Impurity J, Zidovudine Impurity 10(Zidovudine EP Impurity J), 3'-Azido-3'-deoxy-5'-O-tritylthymidine, >95% (HPLC), 3'–Azido–3'–deoxy–5'–O–tritylthymidine. Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1g, 5mg.
1-[(2R,4S,5S)-4-azido-5-(trityloxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (CAS 29706-84-1) is a chemical compound with the molecular formula C29H27N5O4 and a molecular weight of 509.6 g/mol. IUPAC name: 1-[(2R,4S,5S)-4-azido-5-(trityloxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione. InChIKey: AZPSSDWPMSICSH-JIMJEQGWSA-N.
| Molecular formula | C29H27N5O4 |
|---|---|
| Molecular weight | 509.6 g/mol |
| IUPAC name | 1-[(2R,4S,5S)-4-azido-5-(trityloxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChIKey | AZPSSDWPMSICSH-JIMJEQGWSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)COC(C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5)N=[N+]=[N-] |
Computed by PubChem (NCBI)