Products 29710-58-5
CAS 29710-58-5 is the registry number for 1,3-Dimethyl 5-(chlorosulfonyl)benzene-1,3-dicarboxylate. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
Dimethyl 5-chlorosulfonylbenzene-1,3-dicarboxylate (CAS 29710-58-5) is a chemical compound with the molecular formula C10H9ClO6S and a molecular weight of 292.69 g/mol. IUPAC name: dimethyl 5-chlorosulfonylbenzene-1,3-dicarboxylate. InChIKey: OLELLCDSABPKEP-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO6S |
|---|---|
| Molecular weight | 292.69 g/mol |
| IUPAC name | dimethyl 5-chlorosulfonylbenzene-1,3-dicarboxylate |
| InChIKey | OLELLCDSABPKEP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)S(=O)(=O)Cl)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
1,3-Benzenedicarboxylic acid, 5-(chlorosulfonyl)-, 1,3-dimethyl ester, 5-Chlorosulfonyl-isophthalic acid dimethyl ester, Dimethyl 5-chlorosulfonylbenzene-1,3-dicarboxylate, dimethyl 5-(chlorosulfonyl)benzene-1,3-dicarboxylate, 3,5-Dimethoxycarbonylbenzenesulfonyl chloride, 5-chlorosulfonylisophthalic acid dimethyl ester, 1,3-benzenedicarboxylic acid, 5-(chlorosulfonyl)-, dimethyl ester