Products 2971027-11-7
CAS 2971027-11-7 is the registry number for 2-(3-Chloro-2-fluoro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: AmBeed. Available pack sizes: 25g, 10g, 5g.
2-(3-chloro-2-fluoro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2971027-11-7) is a chemical compound with the molecular formula C13H17BClFO3 and a molecular weight of 286.53 g/mol. IUPAC name: 2-(3-chloro-2-fluoro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: XSGBREWHJZZHDX-UHFFFAOYSA-N.
| Molecular formula | C13H17BClFO3 |
|---|---|
| Molecular weight | 286.53 g/mol |
| IUPAC name | 2-(3-chloro-2-fluoro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | XSGBREWHJZZHDX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2F)Cl)OC |
Computed by PubChem (NCBI)