Products 2971837-95-1
CAS 2971837-95-1 is the registry number for ERα degrader 8. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-[4-[3-(2-ethylbenzoyl)-7-hydroxyquinolin-4-yl]oxyphenyl]prop-2-enoic acid (CAS 2971837-95-1) is a chemical compound with the molecular formula C27H21NO5 and a molecular weight of 439.5 g/mol. IUPAC name: (E)-3-[4-[3-(2-ethylbenzoyl)-7-hydroxyquinolin-4-yl]oxyphenyl]prop-2-enoic acid. InChIKey: UESGQWRBQKCKQA-NTEUORMPSA-N.
| Molecular formula | C27H21NO5 |
|---|---|
| Molecular weight | 439.5 g/mol |
| IUPAC name | (E)-3-[4-[3-(2-ethylbenzoyl)-7-hydroxyquinolin-4-yl]oxyphenyl]prop-2-enoic acid |
| InChIKey | UESGQWRBQKCKQA-NTEUORMPSA-N |
| SMILES | CCC1=CC=CC=C1C(=O)C2=CN=C3C=C(C=CC3=C2OC4=CC=C(C=C4)/C=C/C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
ER|A degrader 8, orb2564543