Products 2972675-73-1

CAS 2972675-73-1 is the registry number for 4-Fluoro-3-methoxy-2,6-dimethylaniline, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

4-fluoro-3-methoxy-2,6-dimethylaniline (CAS 2972675-73-1) is a chemical compound with the molecular formula C9H12FNO and a molecular weight of 169.20 g/mol. IUPAC name: 4-fluoro-3-methoxy-2,6-dimethylaniline. InChIKey: WRYGBSLYKVXTIS-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12FNO
Molecular weight169.20 g/mol
IUPAC name4-fluoro-3-methoxy-2,6-dimethylaniline
InChIKeyWRYGBSLYKVXTIS-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1N)C)OC)F

Computed by PubChem (NCBI)