CAS 2972712-63-1 appears in our catalog under these names: KA2507 monohydrochloride, KA2507 (monohydrochloride), 99.43%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
4-[[di(pyrazin-2-yl)amino]methyl]-N-hydroxybenzamide;hydrochloride (CAS 2972712-63-1) is a chemical compound with the molecular formula C16H15ClN6O2 and a molecular weight of 358.78 g/mol. IUPAC name: 4-[[di(pyrazin-2-yl)amino]methyl]-N-hydroxybenzamide;hydrochloride. InChIKey: UCXKKIUOTJPTCM-UHFFFAOYSA-N.
| Molecular formula | C16H15ClN6O2 |
|---|---|
| Molecular weight | 358.78 g/mol |
| IUPAC name | 4-[[di(pyrazin-2-yl)amino]methyl]-N-hydroxybenzamide;hydrochloride |
| InChIKey | UCXKKIUOTJPTCM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN(C2=NC=CN=C2)C3=NC=CN=C3)C(=O)NO.Cl |
Computed by PubChem (NCBI)