Products 2973377-10-3
CAS 2973377-10-3 is the registry number for tau/Aβ40 aggregation-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-methoxy-4-methyl-1-[2-(1-methylpiperidin-4-yl)ethylamino]thioxanthen-9-one (CAS 2973377-10-3) is a chemical compound with the molecular formula C23H28N2O2S and a molecular weight of 396.5 g/mol. IUPAC name: 7-methoxy-4-methyl-1-[2-(1-methylpiperidin-4-yl)ethylamino]thioxanthen-9-one. InChIKey: RGJSERYMQYYVAH-UHFFFAOYSA-N.
| Molecular formula | C23H28N2O2S |
|---|---|
| Molecular weight | 396.5 g/mol |
| IUPAC name | 7-methoxy-4-methyl-1-[2-(1-methylpiperidin-4-yl)ethylamino]thioxanthen-9-one |
| InChIKey | RGJSERYMQYYVAH-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)NCCC3CCN(CC3)C)C(=O)C4=C(S2)C=CC(=C4)OC |
Computed by PubChem (NCBI)
Synonyms:
tau/A|A40 aggregation-IN-1