CAS 2973395-40-1 is the registry number for DHX9-IN-18. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[3-chloro-5-(methanesulfonamido)phenyl]-1-phenylimidazole-4-carboxamide (CAS 2973395-40-1) is a chemical compound with the molecular formula C17H15ClN4O3S and a molecular weight of 390.8 g/mol. IUPAC name: N-[3-chloro-5-(methanesulfonamido)phenyl]-1-phenylimidazole-4-carboxamide. InChIKey: ZQZRMKFVSXMDIA-UHFFFAOYSA-N.
| Molecular formula | C17H15ClN4O3S |
|---|---|
| Molecular weight | 390.8 g/mol |
| IUPAC name | N-[3-chloro-5-(methanesulfonamido)phenyl]-1-phenylimidazole-4-carboxamide |
| InChIKey | ZQZRMKFVSXMDIA-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CC(=CC(=C1)NC(=O)C2=CN(C=N2)C3=CC=CC=C3)Cl |
Computed by PubChem (NCBI)