Products 2973423-76-4
CAS 2973423-76-4 is the registry number for rac-(1R,5S)-2-Oxabicyclo(3.2.0)heptan-6-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,05g, 0,1g, 0,25g.
(1S,5R)-2-oxabicyclo[3.2.0]heptan-6-amine;hydrochloride (CAS 2973423-76-4) is a chemical compound with the molecular formula C6H12ClNO and a molecular weight of 149.62 g/mol. IUPAC name: (1S,5R)-2-oxabicyclo[3.2.0]heptan-6-amine;hydrochloride. InChIKey: VQJOQEOPGZUGMT-KQWAVXQLSA-N.
| Molecular formula | C6H12ClNO |
|---|---|
| Molecular weight | 149.62 g/mol |
| IUPAC name | (1S,5R)-2-oxabicyclo[3.2.0]heptan-6-amine;hydrochloride |
| InChIKey | VQJOQEOPGZUGMT-KQWAVXQLSA-N |
| SMILES | C1CO[C@@H]2[C@H]1C(C2)N.Cl |
Computed by PubChem (NCBI)